C11H17N3O4S — CID 61154717
(2S)-2-amino-3-(4-hydroxyphenyl)-N-(2-sulfamoylethyl)propanamide (PubChem CID 61154717) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)-N-(2-sulfamoylethyl)propanamide.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)-N-(2-sulfamoylethyl)propanamide |
|---|---|
| PubChem CID | 61154717 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)-N-(2-sulfamoylethyl)propanamide |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C11H17N3O4S/c12-10(7-8-1-3-9(15)4-2-8)11(16)14-5-6-19(13,17)18/h1-4,10,15H,5-7,12H2,(H,14,16)(H2,13,17,18)/t10-/m0/s1 |
| InChIKey | JYTLSRLBFIQOSH-JTQLQIEISA-N |
| XLogP | -1.33 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |