C15H19N3O2 — CID 106391024
(2R)-2-amino-3-(4-hydroxyphenyl)-N-(2-pyrrol-1-ylethyl)propanamide (PubChem CID 106391024) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (2R)-2-amino-3-(4-hydroxyphenyl)-N-(2-pyrrol-1-ylethyl)propanamide.
| Compound Name | (2R)-2-amino-3-(4-hydroxyphenyl)-N-(2-pyrrol-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 106391024 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (2R)-2-amino-3-(4-hydroxyphenyl)-N-(2-pyrrol-1-ylethyl)propanamide |
| SMILES | N[C@H](Cc1ccc(O)cc1)C(=O)NCCn1cccc1 |
| InChI | InChI=1S/C15H19N3O2/c16-14(11-12-3-5-13(19)6-4-12)15(20)17-7-10-18-8-1-2-9-18/h1-6,8-9,14,19H,7,10-11,16H2,(H,17,20)/t14-/m1/s1 |
| InChIKey | COPRLSFDHISLRJ-CQSZACIVSA-N |
| XLogP | 0.88 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |