C8H12N4O3S — CID 62155665
2-amino-N-(2-sulfamoylethyl)pyridine-4-carboxamide (PubChem CID 62155665) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-amino-N-(2-sulfamoylethyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-N-(2-sulfamoylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62155665 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-amino-N-(2-sulfamoylethyl)pyridine-4-carboxamide |
| SMILES | Nc1cc(C(=O)NCCS(N)(=O)=O)ccn1 |
| InChI | InChI=1S/C8H12N4O3S/c9-7-5-6(1-2-11-7)8(13)12-3-4-16(10,14)15/h1-2,5H,3-4H2,(H2,9,11)(H,12,13)(H2,10,14,15) |
| InChIKey | JOYUFSPEEZUFAW-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |