C11H14F3N3O — CID 115522139
2-amino-N-(5,5,5-trifluoropentyl)pyridine-4-carboxamide (PubChem CID 115522139) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 2-amino-N-(5,5,5-trifluoropentyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-N-(5,5,5-trifluoropentyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115522139 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-amino-N-(5,5,5-trifluoropentyl)pyridine-4-carboxamide |
| SMILES | Nc1cc(C(=O)NCCCCC(F)(F)F)ccn1 |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)4-1-2-5-17-10(18)8-3-6-16-9(15)7-8/h3,6-7H,1-2,4-5H2,(H2,15,16)(H,17,18) |
| InChIKey | JIAXZMBDBKMKAO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|