C13H21N3O2 — CID 106015103
2-amino-N-(4-propan-2-yloxybutyl)pyridine-4-carboxamide (PubChem CID 106015103) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-amino-N-(4-propan-2-yloxybutyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-N-(4-propan-2-yloxybutyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106015103 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-amino-N-(4-propan-2-yloxybutyl)pyridine-4-carboxamide |
| SMILES | CC(C)OCCCCNC(=O)c1ccnc(N)c1 |
| InChI | InChI=1S/C13H21N3O2/c1-10(2)18-8-4-3-6-16-13(17)11-5-7-15-12(14)9-11/h5,7,9-10H,3-4,6,8H2,1-2H3,(H2,14,15)(H,16,17) |
| InChIKey | SIHOCIXDJMDATH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|