C17H28N2O3 — CID 93216664
4-amino-3-(2-methylpropoxy)-N-(3-propan-2-yloxypropyl)benzamide (PubChem CID 93216664) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 4-amino-3-(2-methylpropoxy)-N-(3-propan-2-yloxypropyl)benzamide.
| Compound Name | 4-amino-3-(2-methylpropoxy)-N-(3-propan-2-yloxypropyl)benzamide |
|---|---|
| PubChem CID | 93216664 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 4-amino-3-(2-methylpropoxy)-N-(3-propan-2-yloxypropyl)benzamide |
| SMILES | CC(C)COc1cc(C(=O)NCCCOC(C)C)ccc1N |
| InChI | InChI=1S/C17H28N2O3/c1-12(2)11-22-16-10-14(6-7-15(16)18)17(20)19-8-5-9-21-13(3)4/h6-7,10,12-13H,5,8-9,11,18H2,1-4H3,(H,19,20) |
| InChIKey | WPWBNCRCFXHJRO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|