C11H12ClF3N2O — CID 113326613
3-amino-4-chloro-N-(4,4,4-trifluorobutyl)benzamide (PubChem CID 113326613) has the molecular formula C11H12ClF3N2O and a molecular weight of 280.68 g/mol. Its IUPAC name is 3-amino-4-chloro-N-(4,4,4-trifluorobutyl)benzamide.
| Compound Name | 3-amino-4-chloro-N-(4,4,4-trifluorobutyl)benzamide |
|---|---|
| PubChem CID | 113326613 |
| Molecular Formula | C11H12ClF3N2O |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 3-amino-4-chloro-N-(4,4,4-trifluorobutyl)benzamide |
| SMILES | Nc1cc(C(=O)NCCCC(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H12ClF3N2O/c12-8-3-2-7(6-9(8)16)10(18)17-5-1-4-11(13,14)15/h2-3,6H,1,4-5,16H2,(H,17,18) |
| InChIKey | FJBUHHCTMDHBDO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|