C11H14F3N3O — CID 115522193
4-hydrazinyl-N-(4,4,4-trifluorobutyl)benzamide (PubChem CID 115522193) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 4-hydrazinyl-N-(4,4,4-trifluorobutyl)benzamide.
| Compound Name | 4-hydrazinyl-N-(4,4,4-trifluorobutyl)benzamide |
|---|---|
| PubChem CID | 115522193 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-hydrazinyl-N-(4,4,4-trifluorobutyl)benzamide |
| SMILES | NNc1ccc(C(=O)NCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)6-1-7-16-10(18)8-2-4-9(17-15)5-3-8/h2-5,17H,1,6-7,15H2,(H,16,18) |
| InChIKey | BKEFUDACFWTWCW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|