C11H11F3INO — CID 79039211
4-iodo-N-(4,4,4-trifluorobutyl)benzamide (PubChem CID 79039211) has the molecular formula C11H11F3INO and a molecular weight of 357.11 g/mol. Its IUPAC name is 4-iodo-N-(4,4,4-trifluorobutyl)benzamide.
| Compound Name | 4-iodo-N-(4,4,4-trifluorobutyl)benzamide |
|---|---|
| PubChem CID | 79039211 |
| Molecular Formula | C11H11F3INO |
| Molecular Weight | 357.11 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 4-iodo-N-(4,4,4-trifluorobutyl)benzamide |
| SMILES | O=C(NCCCC(F)(F)F)c1ccc(I)cc1 |
| InChI | InChI=1S/C11H11F3INO/c12-11(13,14)6-1-7-16-10(17)8-2-4-9(15)5-3-8/h2-5H,1,6-7H2,(H,16,17) |
| InChIKey | WRZMVSCZJKWJNX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.11 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|