C11H11ClF3NO3S — CID 115519611
4-(4,4,4-trifluorobutylcarbamoyl)benzenesulfonyl chloride (PubChem CID 115519611) has the molecular formula C11H11ClF3NO3S and a molecular weight of 329.73 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 4-(4,4,4-trifluorobutylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 115519611 |
| Molecular Formula | C11H11ClF3NO3S |
| Molecular Weight | 329.73 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 4-(4,4,4-trifluorobutylcarbamoyl)benzenesulfonyl chloride |
| SMILES | O=C(NCCCC(F)(F)F)c1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C11H11ClF3NO3S/c12-20(18,19)9-4-2-8(3-5-9)10(17)16-7-1-6-11(13,14)15/h2-5H,1,6-7H2,(H,16,17) |
| InChIKey | RRNFEKSXDSKWHX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.73 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|