C10H10BrF3N2O — CID 79420880
6-bromo-N-(4,4,4-trifluorobutyl)pyridine-3-carboxamide (PubChem CID 79420880) has the molecular formula C10H10BrF3N2O and a molecular weight of 311.10 g/mol. Its IUPAC name is 6-bromo-N-(4,4,4-trifluorobutyl)pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-(4,4,4-trifluorobutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79420880 |
| Molecular Formula | C10H10BrF3N2O |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 6-bromo-N-(4,4,4-trifluorobutyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCCC(F)(F)F)c1ccc(Br)nc1 |
| InChI | InChI=1S/C10H10BrF3N2O/c11-8-3-2-7(6-16-8)9(17)15-5-1-4-10(12,13)14/h2-3,6H,1,4-5H2,(H,15,17) |
| InChIKey | PHRZXDGRBZQRIK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|