C10H10BrF3N2O2 — CID 66462180
6-bromo-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide (PubChem CID 66462180) has the molecular formula C10H10BrF3N2O2 and a molecular weight of 327.10 g/mol. Its IUPAC name is 6-bromo-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66462180 |
| Molecular Formula | C10H10BrF3N2O2 |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 6-bromo-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCOCC(F)(F)F)c1ccc(Br)nc1 |
| InChI | InChI=1S/C10H10BrF3N2O2/c11-8-2-1-7(5-16-8)9(17)15-3-4-18-6-10(12,13)14/h1-2,5H,3-4,6H2,(H,15,17) |
| InChIKey | MFTDYYZSZWFXGS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|