C11H10BrF3N2O4 — CID 60730880
4-bromo-3-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide (PubChem CID 60730880) has the molecular formula C11H10BrF3N2O4 and a molecular weight of 371.11 g/mol. Its IUPAC name is 4-bromo-3-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide.
| Compound Name | 4-bromo-3-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 60730880 |
| Molecular Formula | C11H10BrF3N2O4 |
| Molecular Weight | 371.11 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 4-bromo-3-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
| SMILES | O=C(NCCOCC(F)(F)F)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10BrF3N2O4/c12-8-2-1-7(5-9(8)17(19)20)10(18)16-3-4-21-6-11(13,14)15/h1-2,5H,3-4,6H2,(H,16,18) |
| InChIKey | HXVJOUYORDVANR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.11 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|