C11H10BrF3N2O3 — CID 104854996
4-bromo-3-nitro-N-(4,4,4-trifluorobutan-2-yl)benzamide (PubChem CID 104854996) has the molecular formula C11H10BrF3N2O3 and a molecular weight of 355.11 g/mol. Its IUPAC name is 4-bromo-3-nitro-N-(4,4,4-trifluorobutan-2-yl)benzamide.
| Compound Name | 4-bromo-3-nitro-N-(4,4,4-trifluorobutan-2-yl)benzamide |
|---|---|
| PubChem CID | 104854996 |
| Molecular Formula | C11H10BrF3N2O3 |
| Molecular Weight | 355.11 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 4-bromo-3-nitro-N-(4,4,4-trifluorobutan-2-yl)benzamide |
| SMILES | CC(CC(F)(F)F)NC(=O)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10BrF3N2O3/c1-6(5-11(13,14)15)16-10(18)7-2-3-8(12)9(4-7)17(19)20/h2-4,6H,5H2,1H3,(H,16,18) |
| InChIKey | UNCOKMPKGXTNGE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.11 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|