C11H10BrClF3NO — CID 104854902
3-bromo-4-chloro-N-(4,4,4-trifluorobutan-2-yl)benzamide (PubChem CID 104854902) has the molecular formula C11H10BrClF3NO and a molecular weight of 344.56 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-(4,4,4-trifluorobutan-2-yl)benzamide.
| Compound Name | 3-bromo-4-chloro-N-(4,4,4-trifluorobutan-2-yl)benzamide |
|---|---|
| PubChem CID | 104854902 |
| Molecular Formula | C11H10BrClF3NO |
| Molecular Weight | 344.56 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 3-bromo-4-chloro-N-(4,4,4-trifluorobutan-2-yl)benzamide |
| SMILES | CC(CC(F)(F)F)NC(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C11H10BrClF3NO/c1-6(5-11(14,15)16)17-10(18)7-2-3-9(13)8(12)4-7/h2-4,6H,5H2,1H3,(H,17,18) |
| InChIKey | GWXWZRPDEUIWLK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |