C14H19BrN2O3 — CID 78965821
4-bromo-3-nitro-N-(2,3,3-trimethylbutyl)benzamide (PubChem CID 78965821) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 4-bromo-3-nitro-N-(2,3,3-trimethylbutyl)benzamide.
| Compound Name | 4-bromo-3-nitro-N-(2,3,3-trimethylbutyl)benzamide |
|---|---|
| PubChem CID | 78965821 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 4-bromo-3-nitro-N-(2,3,3-trimethylbutyl)benzamide |
| SMILES | CC(CNC(=O)c1ccc(Br)c([N+](=O)[O-])c1)C(C)(C)C |
| InChI | InChI=1S/C14H19BrN2O3/c1-9(14(2,3)4)8-16-13(18)10-5-6-11(15)12(7-10)17(19)20/h5-7,9H,8H2,1-4H3,(H,16,18) |
| InChIKey | ZJHLPFNSZMOPOQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|