C14H21BrN2O — CID 83143162
4-amino-3-bromo-N-(2,3,3-trimethylbutyl)benzamide (PubChem CID 83143162) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is 4-amino-3-bromo-N-(2,3,3-trimethylbutyl)benzamide.
| Compound Name | 4-amino-3-bromo-N-(2,3,3-trimethylbutyl)benzamide |
|---|---|
| PubChem CID | 83143162 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 4-amino-3-bromo-N-(2,3,3-trimethylbutyl)benzamide |
| SMILES | CC(CNC(=O)c1ccc(N)c(Br)c1)C(C)(C)C |
| InChI | InChI=1S/C14H21BrN2O/c1-9(14(2,3)4)8-17-13(18)10-5-6-12(16)11(15)7-10/h5-7,9H,8,16H2,1-4H3,(H,17,18) |
| InChIKey | YPOBQWPWHHDCHP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|