C14H19BrClNO3S — CID 83145232
2-bromo-5-(2,3,3-trimethylbutylcarbamoyl)benzenesulfonyl chloride (PubChem CID 83145232) has the molecular formula C14H19BrClNO3S and a molecular weight of 396.73 g/mol. Its IUPAC name is 2-bromo-5-(2,3,3-trimethylbutylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 2-bromo-5-(2,3,3-trimethylbutylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 83145232 |
| Molecular Formula | C14H19BrClNO3S |
| Molecular Weight | 396.73 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 2-bromo-5-(2,3,3-trimethylbutylcarbamoyl)benzenesulfonyl chloride |
| SMILES | CC(CNC(=O)c1ccc(Br)c(S(=O)(=O)Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C14H19BrClNO3S/c1-9(14(2,3)4)8-17-13(18)10-5-6-11(15)12(7-10)21(16,19)20/h5-7,9H,8H2,1-4H3,(H,17,18) |
| InChIKey | YVUFTFZVKPENMH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.73 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |