C13H15BrN2O5 — CID 61144118
(2S)-2-[(4-bromo-3-nitrobenzoyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 61144118) has the molecular formula C13H15BrN2O5 and a molecular weight of 359.18 g/mol. Its IUPAC name is (2S)-2-[(4-bromo-3-nitrobenzoyl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[(4-bromo-3-nitrobenzoyl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 61144118 |
| Molecular Formula | C13H15BrN2O5 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | (2S)-2-[(4-bromo-3-nitrobenzoyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)c1ccc(Br)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C13H15BrN2O5/c1-13(2,3)10(12(18)19)15-11(17)7-4-5-8(14)9(6-7)16(20)21/h4-6,10H,1-3H3,(H,15,17)(H,18,19)/t10-/m1/s1 |
| InChIKey | JEHAYWHSEOVAIP-SNVBAGLBSA-N |
| XLogP | 2.59 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|