C13H15N3O7 — CID 14178524
2-[(3,5-dinitrobenzoyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 14178524) has the molecular formula C13H15N3O7 and a molecular weight of 325.28 g/mol. Its IUPAC name is 2-[(3,5-dinitrobenzoyl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(3,5-dinitrobenzoyl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 14178524 |
| Molecular Formula | C13H15N3O7 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-[(3,5-dinitrobenzoyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C13H15N3O7/c1-13(2,3)10(12(18)19)14-11(17)7-4-8(15(20)21)6-9(5-7)16(22)23/h4-6,10H,1-3H3,(H,14,17)(H,18,19) |
| InChIKey | REDWBJOXLLTWBG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|