C17H17N3O7 — CID 144760970
(2S)-2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid;ethane (PubChem CID 144760970) has the molecular formula C17H17N3O7 and a molecular weight of 375.34 g/mol. Its IUPAC name is (2S)-2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid;ethane.
| Compound Name | (2S)-2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid;ethane |
|---|---|
| PubChem CID | 144760970 |
| Molecular Formula | C17H17N3O7 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (2S)-2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid;ethane |
| SMILES | CC.O=C(N[C@H](C(=O)O)c1ccccc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11N3O7.C2H6/c19-14(16-13(15(20)21)9-4-2-1-3-5-9)10-6-11(17(22)23)8-12(7-10)18(24)25;1-2/h1-8,13H,(H,16,19)(H,20,21);1-2H3/t13-;/m0./s1 |
| InChIKey | HYEDLADFVRNPKK-ZOWNYOTGSA-N |
| XLogP | 3.08 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|