C18H17N3O7 — CID 87094828
(2S)-2-[[(3,5-dinitrobenzoyl)amino]-phenylmethyl]butanoic acid (PubChem CID 87094828) has the molecular formula C18H17N3O7 and a molecular weight of 387.35 g/mol. Its IUPAC name is (2S)-2-[[(3,5-dinitrobenzoyl)amino]-phenylmethyl]butanoic acid.
| Compound Name | (2S)-2-[[(3,5-dinitrobenzoyl)amino]-phenylmethyl]butanoic acid |
|---|---|
| PubChem CID | 87094828 |
| Molecular Formula | C18H17N3O7 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (2S)-2-[[(3,5-dinitrobenzoyl)amino]-phenylmethyl]butanoic acid |
| SMILES | CC[C@H](C(=O)O)C(NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O7/c1-2-15(18(23)24)16(11-6-4-3-5-7-11)19-17(22)12-8-13(20(25)26)10-14(9-12)21(27)28/h3-10,15-16H,2H2,1H3,(H,19,22)(H,23,24)/t15-,16?/m0/s1 |
| InChIKey | MRUURSVHGINGAB-VYRBHSGPSA-N |
| XLogP | 3.08 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|