C23H16BrN3O8 — CID 135049945
[2-(4-bromophenyl)-2-oxoethyl] 2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetate (PubChem CID 135049945) has the molecular formula C23H16BrN3O8 and a molecular weight of 542.30 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 135049945 |
| Molecular Formula | C23H16BrN3O8 |
| Molecular Weight | 542.30 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetate |
| SMILES | O=C(COC(=O)C(NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H16BrN3O8/c24-17-8-6-14(7-9-17)20(28)13-35-23(30)21(15-4-2-1-3-5-15)25-22(29)16-10-18(26(31)32)12-19(11-16)27(33)34/h1-12,21H,13H2,(H,25,29) |
| InChIKey | QQAJMBJMJFKVQE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 158.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|