C14H11N3O6 — CID 14025295
(2R)-2-(3,5-dinitroanilino)-2-phenylacetic acid (PubChem CID 14025295) has the molecular formula C14H11N3O6 and a molecular weight of 317.26 g/mol. Its IUPAC name is (2R)-2-(3,5-dinitroanilino)-2-phenylacetic acid.
| Compound Name | (2R)-2-(3,5-dinitroanilino)-2-phenylacetic acid |
|---|---|
| PubChem CID | 14025295 |
| Molecular Formula | C14H11N3O6 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (2R)-2-(3,5-dinitroanilino)-2-phenylacetic acid |
| SMILES | O=C(O)[C@H](Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C14H11N3O6/c18-14(19)13(9-4-2-1-3-5-9)15-10-6-11(16(20)21)8-12(7-10)17(22)23/h1-8,13,15H,(H,18,19)/t13-/m1/s1 |
| InChIKey | ZZQHVXBEYBXACL-CYBMUJFWSA-N |
| XLogP | 2.74 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|