C22H18N2O5 — CID 67571498
(2S)-2-[(2,2-diphenylacetyl)amino]-2-(3-nitrophenyl)acetic acid (PubChem CID 67571498) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is (2S)-2-[(2,2-diphenylacetyl)amino]-2-(3-nitrophenyl)acetic acid.
| Compound Name | (2S)-2-[(2,2-diphenylacetyl)amino]-2-(3-nitrophenyl)acetic acid |
|---|---|
| PubChem CID | 67571498 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (2S)-2-[(2,2-diphenylacetyl)amino]-2-(3-nitrophenyl)acetic acid |
| SMILES | O=C(N[C@H](C(=O)O)c1cccc([N+](=O)[O-])c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O5/c25-21(19(15-8-3-1-4-9-15)16-10-5-2-6-11-16)23-20(22(26)27)17-12-7-13-18(14-17)24(28)29/h1-14,19-20H,(H,23,25)(H,26,27)/t20-/m0/s1 |
| InChIKey | ZBZWFLFRRVGZQS-FQEVSTJZSA-N |
| XLogP | 3.67 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|