(2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid

C9H7Br2NO4 — CID 11175622

IUPAC(2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid
SMILESO=C(O)[C@@H](Br)[C@@H](Br)c1cccc([N+](=O)[O-])c1
InChIInChI=1S/C9H7Br2NO4/c10-7(8(11)9(13)14)5-2-1-3-6(4-5)12(15)16/h1-4,7-8H,(H,13,14)/t7-,8-/m0/s1
InChIKeyAYUJMWVMPDGXFF-YUMQZZPRSA-N
MW352.97 g/mol
LogP2.88
Rot. Bonds4

About (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid

(2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid (PubChem CID 11175622) has the molecular formula C9H7Br2NO4 and a molecular weight of 352.97 g/mol. Its IUPAC name is (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid.

Molecular Properties

Compound Name(2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid
PubChem CID11175622
Molecular FormulaC9H7Br2NO4
Molecular Weight352.97 g/mol
Exact Mass350.87
IUPAC Name(2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid
SMILESO=C(O)[C@@H](Br)[C@@H](Br)c1cccc([N+](=O)[O-])c1
InChIInChI=1S/C9H7Br2NO4/c10-7(8(11)9(13)14)5-2-1-3-6(4-5)12(15)16/h1-4,7-8H,(H,13,14)/t7-,8-/m0/s1
InChIKeyAYUJMWVMPDGXFF-YUMQZZPRSA-N
XLogP2.88
TPSA80.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.97
LogP ≤ 52.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid?
The IUPAC name of (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid (CID 11175622) is (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid.
What is the SMILES notation for (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid?
The canonical SMILES for (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid is O=C(O)[C@@H](Br)[C@@H](Br)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid?
The InChIKey is AYUJMWVMPDGXFF-YUMQZZPRSA-N. The full InChI is InChI=1S/C9H7Br2NO4/c10-7(8(11)9(13)14)5-2-1-3-6(4-5)12(15)16/h1-4,7-8H,(H,13,14)/t7-,8-/m0/s1.
What are the key properties of (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid?
(2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid has a molecular weight of 352.97 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid is sourced from PubChem (CID 11175622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).