C9H7Br2NO4 — CID 11175622
(2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid (PubChem CID 11175622) has the molecular formula C9H7Br2NO4 and a molecular weight of 352.97 g/mol. Its IUPAC name is (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid.
| Compound Name | (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 11175622 |
| Molecular Formula | C9H7Br2NO4 |
| Molecular Weight | 352.97 g/mol |
| Exact Mass | 350.87 |
| IUPAC Name | (2R,3S)-2,3-dibromo-3-(3-nitrophenyl)propanoic acid |
| SMILES | O=C(O)[C@@H](Br)[C@@H](Br)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H7Br2NO4/c10-7(8(11)9(13)14)5-2-1-3-6(4-5)12(15)16/h1-4,7-8H,(H,13,14)/t7-,8-/m0/s1 |
| InChIKey | AYUJMWVMPDGXFF-YUMQZZPRSA-N |
| XLogP | 2.88 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.97 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|