C12H12N2O8 — CID 122370473
(2R)-2-[bis(carboxymethyl)amino]-2-(3-nitrophenyl)acetic acid (PubChem CID 122370473) has the molecular formula C12H12N2O8 and a molecular weight of 312.23 g/mol. Its IUPAC name is (2R)-2-[bis(carboxymethyl)amino]-2-(3-nitrophenyl)acetic acid.
| Compound Name | (2R)-2-[bis(carboxymethyl)amino]-2-(3-nitrophenyl)acetic acid |
|---|---|
| PubChem CID | 122370473 |
| Molecular Formula | C12H12N2O8 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (2R)-2-[bis(carboxymethyl)amino]-2-(3-nitrophenyl)acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)[C@@H](C(=O)O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12N2O8/c15-9(16)5-13(6-10(17)18)11(12(19)20)7-2-1-3-8(4-7)14(21)22/h1-4,11H,5-6H2,(H,15,16)(H,17,18)(H,19,20)/t11-/m1/s1 |
| InChIKey | NLUMBKAUTMKKRR-LLVKDONJSA-N |
| XLogP | 0.19 |
| TPSA | 158.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|