C18H15N3O5 — CID 88524829
2-[benzoyl-(prop-2-ynylamino)amino]-2-(3-nitrophenyl)acetic acid (PubChem CID 88524829) has the molecular formula C18H15N3O5 and a molecular weight of 353.33 g/mol. Its IUPAC name is 2-[benzoyl-(prop-2-ynylamino)amino]-2-(3-nitrophenyl)acetic acid.
| Compound Name | 2-[benzoyl-(prop-2-ynylamino)amino]-2-(3-nitrophenyl)acetic acid |
|---|---|
| PubChem CID | 88524829 |
| Molecular Formula | C18H15N3O5 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[benzoyl-(prop-2-ynylamino)amino]-2-(3-nitrophenyl)acetic acid |
| SMILES | C#CCNN(C(=O)c1ccccc1)C(C(=O)O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15N3O5/c1-2-11-19-20(17(22)13-7-4-3-5-8-13)16(18(23)24)14-9-6-10-15(12-14)21(25)26/h1,3-10,12,16,19H,11H2,(H,23,24) |
| InChIKey | HOEICYHUEVUWFS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|