2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid

C16H10N2O6 — CID 154154431

IUPAC2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid
SMILESO=C(O)C(c1cccc([N+](=O)[O-])c1)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C16H10N2O6/c19-14-11-6-1-2-7-12(11)15(20)17(14)13(16(21)22)9-4-3-5-10(8-9)18(23)24/h1-8,13H,(H,21,22)
InChIKeyICZGFBYDPWORRQ-UHFFFAOYSA-N
MW326.26 g/mol
LogP2.02
Rot. Bonds4

About 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid

2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid (PubChem CID 154154431) has the molecular formula C16H10N2O6 and a molecular weight of 326.26 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid.

Molecular Properties

Compound Name2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid
PubChem CID154154431
Molecular FormulaC16H10N2O6
Molecular Weight326.26 g/mol
Exact Mass326.05
IUPAC Name2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid
SMILESO=C(O)C(c1cccc([N+](=O)[O-])c1)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C16H10N2O6/c19-14-11-6-1-2-7-12(11)15(20)17(14)13(16(21)22)9-4-3-5-10(8-9)18(23)24/h1-8,13H,(H,21,22)
InChIKeyICZGFBYDPWORRQ-UHFFFAOYSA-N
XLogP2.02
TPSA117.82 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.26
LogP ≤ 52.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid?
The IUPAC name of 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid (CID 154154431) is 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid.
What is the SMILES notation for 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid?
The canonical SMILES for 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid is O=C(O)C(c1cccc([N+](=O)[O-])c1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid?
The InChIKey is ICZGFBYDPWORRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O6/c19-14-11-6-1-2-7-12(11)15(20)17(14)13(16(21)22)9-4-3-5-10(8-9)18(23)24/h1-8,13H,(H,21,22).
What are the key properties of 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid?
2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid has a molecular weight of 326.26 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid is sourced from PubChem (CID 154154431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).