C16H10N2O6 — CID 154154431
2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid (PubChem CID 154154431) has the molecular formula C16H10N2O6 and a molecular weight of 326.26 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid |
|---|---|
| PubChem CID | 154154431 |
| Molecular Formula | C16H10N2O6 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-2-(3-nitrophenyl)acetic acid |
| SMILES | O=C(O)C(c1cccc([N+](=O)[O-])c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H10N2O6/c19-14-11-6-1-2-7-12(11)15(20)17(14)13(16(21)22)9-4-3-5-10(8-9)18(23)24/h1-8,13H,(H,21,22) |
| InChIKey | ICZGFBYDPWORRQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|