C25H25N3O4 — CID 27877890
(2R)-N-benzhydryl-2-morpholin-4-yl-2-(3-nitrophenyl)acetamide (PubChem CID 27877890) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (2R)-N-benzhydryl-2-morpholin-4-yl-2-(3-nitrophenyl)acetamide.
| Compound Name | (2R)-N-benzhydryl-2-morpholin-4-yl-2-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 27877890 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (2R)-N-benzhydryl-2-morpholin-4-yl-2-(3-nitrophenyl)acetamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)[C@@H](c1cccc([N+](=O)[O-])c1)N1CCOCC1 |
| InChI | InChI=1S/C25H25N3O4/c29-25(26-23(19-8-3-1-4-9-19)20-10-5-2-6-11-20)24(27-14-16-32-17-15-27)21-12-7-13-22(18-21)28(30)31/h1-13,18,23-24H,14-17H2,(H,26,29)/t24-/m1/s1 |
| InChIKey | NOKAKFYARPFZPP-XMMPIXPASA-N |
| XLogP | 3.87 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|