C19H14N2O6 — CID 132541324
methyl 2-[(S)-(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate (PubChem CID 132541324) has the molecular formula C19H14N2O6 and a molecular weight of 366.33 g/mol. Its IUPAC name is methyl 2-[(S)-(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate.
| Compound Name | methyl 2-[(S)-(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 132541324 |
| Molecular Formula | C19H14N2O6 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | methyl 2-[(S)-(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@H](c1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H14N2O6/c1-11(19(24)27-2)16(12-7-9-13(10-8-12)21(25)26)20-17(22)14-5-3-4-6-15(14)18(20)23/h3-10,16H,1H2,2H3/t16-/m1/s1 |
| InChIKey | FHIWKPWRZWTGLZ-MRXNPFEDSA-N |
| XLogP | 2.66 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|