C17H10N2O5 — CID 71372646
2-[3-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]isoindole-1,3-dione (PubChem CID 71372646) has the molecular formula C17H10N2O5 and a molecular weight of 322.28 g/mol. Its IUPAC name is 2-[3-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[3-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 71372646 |
| Molecular Formula | C17H10N2O5 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-[3-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]isoindole-1,3-dione |
| SMILES | C=C(C(=O)c1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H10N2O5/c1-10(15(20)11-6-8-12(9-7-11)19(23)24)18-16(21)13-4-2-3-5-14(13)17(18)22/h2-9H,1H2 |
| InChIKey | PNGRNZQABTVHDM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|