C16H9N3O5S — CID 155490515
N-(2,3-dioxoindole-1-carbothioyl)-4-nitrobenzamide (PubChem CID 155490515) has the molecular formula C16H9N3O5S and a molecular weight of 355.33 g/mol. Its IUPAC name is N-(2,3-dioxoindole-1-carbothioyl)-4-nitrobenzamide.
| Compound Name | N-(2,3-dioxoindole-1-carbothioyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 155490515 |
| Molecular Formula | C16H9N3O5S |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | N-(2,3-dioxoindole-1-carbothioyl)-4-nitrobenzamide |
| SMILES | O=C(NC(=S)N1C(=O)C(=O)c2ccccc21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H9N3O5S/c20-13-11-3-1-2-4-12(11)18(15(13)22)16(25)17-14(21)9-5-7-10(8-6-9)19(23)24/h1-8H,(H,17,21,25) |
| InChIKey | CEAHGLNRXSDPGB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|