C16H11N3O5 — CID 3704400
2-(2,3-dioxoindol-1-yl)-N-(4-nitrophenyl)acetamide (PubChem CID 3704400) has the molecular formula C16H11N3O5 and a molecular weight of 325.28 g/mol. Its IUPAC name is 2-(2,3-dioxoindol-1-yl)-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-(2,3-dioxoindol-1-yl)-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3704400 |
| Molecular Formula | C16H11N3O5 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-(2,3-dioxoindol-1-yl)-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)c2ccccc21)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H11N3O5/c20-14(17-10-5-7-11(8-6-10)19(23)24)9-18-13-4-2-1-3-12(13)15(21)16(18)22/h1-8H,9H2,(H,17,20) |
| InChIKey | KKDJSVAOORLTRK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|