C17H12N2O5 — CID 3644129
4-[[2-(2,3-dioxoindol-1-yl)acetyl]amino]benzoic acid (PubChem CID 3644129) has the molecular formula C17H12N2O5 and a molecular weight of 324.29 g/mol. Its IUPAC name is 4-[[2-(2,3-dioxoindol-1-yl)acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-(2,3-dioxoindol-1-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 3644129 |
| Molecular Formula | C17H12N2O5 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-[[2-(2,3-dioxoindol-1-yl)acetyl]amino]benzoic acid |
| SMILES | O=C(CN1C(=O)C(=O)c2ccccc21)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H12N2O5/c20-14(18-11-7-5-10(6-8-11)17(23)24)9-19-13-4-2-1-3-12(13)15(21)16(19)22/h1-8H,9H2,(H,18,20)(H,23,24) |
| InChIKey | LIPCERJYXOMKMZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|