C16H11ClN2O3 — CID 73346162
2-(7-chloro-2,3-dioxoindol-1-yl)-N-phenylacetamide (PubChem CID 73346162) has the molecular formula C16H11ClN2O3 and a molecular weight of 314.73 g/mol. Its IUPAC name is 2-(7-chloro-2,3-dioxoindol-1-yl)-N-phenylacetamide.
| Compound Name | 2-(7-chloro-2,3-dioxoindol-1-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 73346162 |
| Molecular Formula | C16H11ClN2O3 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-(7-chloro-2,3-dioxoindol-1-yl)-N-phenylacetamide |
| SMILES | O=C(CN1C(=O)C(=O)c2cccc(Cl)c21)Nc1ccccc1 |
| InChI | InChI=1S/C16H11ClN2O3/c17-12-8-4-7-11-14(12)19(16(22)15(11)21)9-13(20)18-10-5-2-1-3-6-10/h1-8H,9H2,(H,18,20) |
| InChIKey | JSYXLFCBYDNEBR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|