C18H14N2O4 — CID 154148523
4-(1,3-dioxoisoindol-2-yl)-3-oxo-N-phenylbutanamide (PubChem CID 154148523) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-3-oxo-N-phenylbutanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-3-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 154148523 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-3-oxo-N-phenylbutanamide |
| SMILES | O=C(CC(=O)Nc1ccccc1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14N2O4/c21-13(10-16(22)19-12-6-2-1-3-7-12)11-20-17(23)14-8-4-5-9-15(14)18(20)24/h1-9H,10-11H2,(H,19,22) |
| InChIKey | LAACLHNWRLWNCF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|