C20H20N2O3 — CID 7658806
N-(4-tert-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 7658806) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(4-tert-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 7658806 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H20N2O3/c1-20(2,3)13-8-10-14(11-9-13)21-17(23)12-22-18(24)15-6-4-5-7-16(15)19(22)25/h4-11H,12H2,1-3H3,(H,21,23) |
| InChIKey | GUQGPBCJGWKBJK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|