C21H22N2O3 — CID 26776950
2-(1,3-dioxoisoindol-2-yl)-N-(4-pentylphenyl)acetamide (PubChem CID 26776950) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(4-pentylphenyl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-pentylphenyl)acetamide |
|---|---|
| PubChem CID | 26776950 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-pentylphenyl)acetamide |
| SMILES | CCCCCc1ccc(NC(=O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-2-3-4-7-15-10-12-16(13-11-15)22-19(24)14-23-20(25)17-8-5-6-9-18(17)21(23)26/h5-6,8-13H,2-4,7,14H2,1H3,(H,22,24) |
| InChIKey | JCRUSARDEKFRBY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|