C22H22N2O4 — CID 7960039
N-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]phenyl]hexanamide (PubChem CID 7960039) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]phenyl]hexanamide.
| Compound Name | N-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 7960039 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H22N2O4/c1-2-3-4-9-20(26)23-16-12-10-15(11-13-16)19(25)14-24-21(27)17-7-5-6-8-18(17)22(24)28/h5-8,10-13H,2-4,9,14H2,1H3,(H,23,26) |
| InChIKey | RVMIOYSSJJEJJU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|