C19H23N3O5 — CID 7824079
N-[4-[2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]phenyl]hexanamide (PubChem CID 7824079) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[4-[2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]phenyl]hexanamide.
| Compound Name | N-[4-[2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 7824079 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[4-[2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)CN2C(=O)C(=O)N(CC)C2=O)cc1 |
| InChI | InChI=1S/C19H23N3O5/c1-3-5-6-7-16(24)20-14-10-8-13(9-11-14)15(23)12-22-18(26)17(25)21(4-2)19(22)27/h8-11H,3-7,12H2,1-2H3,(H,20,24) |
| InChIKey | KPLYRVXSRHWSBO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|