C24H27N3O4S — CID 40897642
N-[4-[2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]acetyl]phenyl]hexanamide (PubChem CID 40897642) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[4-[2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]acetyl]phenyl]hexanamide.
| Compound Name | N-[4-[2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]acetyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 40897642 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-[4-[2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]acetyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)CN2C(=O)N[C@@]3(CCCc4sccc43)C2=O)cc1 |
| InChI | InChI=1S/C24H27N3O4S/c1-2-3-4-7-21(29)25-17-10-8-16(9-11-17)19(28)15-27-22(30)24(26-23(27)31)13-5-6-20-18(24)12-14-32-20/h8-12,14H,2-7,13,15H2,1H3,(H,25,29)(H,26,31)/t24-/m1/s1 |
| InChIKey | KSYMWHJTJXBPSV-XMMPIXPASA-N |
| XLogP | 4.23 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|