C18H19N3O5 — CID 9458022
2-methyl-N-[4-[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]phenyl]propanamide (PubChem CID 9458022) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-methyl-N-[4-[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]phenyl]propanamide |
|---|---|
| PubChem CID | 9458022 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-methyl-N-[4-[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]phenyl]propanamide |
| SMILES | C=CCN1C(=O)C(=O)N(CC(=O)c2ccc(NC(=O)C(C)C)cc2)C1=O |
| InChI | InChI=1S/C18H19N3O5/c1-4-9-20-16(24)17(25)21(18(20)26)10-14(22)12-5-7-13(8-6-12)19-15(23)11(2)3/h4-8,11H,1,9-10H2,2-3H3,(H,19,23) |
| InChIKey | CDQBMWBVVCRGAE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|