C17H20N4O5 — CID 8626617
N,N-dimethyl-4-[[2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetyl]amino]benzamide (PubChem CID 8626617) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is N,N-dimethyl-4-[[2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetyl]amino]benzamide.
| Compound Name | N,N-dimethyl-4-[[2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8626617 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N,N-dimethyl-4-[[2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetyl]amino]benzamide |
| SMILES | CCCN1C(=O)C(=O)N(CC(=O)Nc2ccc(C(=O)N(C)C)cc2)C1=O |
| InChI | InChI=1S/C17H20N4O5/c1-4-9-20-15(24)16(25)21(17(20)26)10-13(22)18-12-7-5-11(6-8-12)14(23)19(2)3/h5-8H,4,9-10H2,1-3H3,(H,18,22) |
| InChIKey | KIOQPBVSICLOIA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|