C21H21N3O5 — CID 4222608
2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide (PubChem CID 4222608) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4222608 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide |
| SMILES | CCCCN1C(=O)C(=O)N(CC(=O)Nc2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C21H21N3O5/c1-2-3-13-23-19(26)20(27)24(21(23)28)14-18(25)22-15-9-11-17(12-10-15)29-16-7-5-4-6-8-16/h4-12H,2-3,13-14H2,1H3,(H,22,25) |
| InChIKey | OYXMCSOMDBWOEV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|