C24H21N3O4 — CID 46698957
2-(4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide (PubChem CID 46698957) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-(4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-(4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46698957 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-(4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide |
| SMILES | CC1C(=O)N(CC(=O)Nc2ccc(Oc3ccccc3)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C24H21N3O4/c1-17-23(29)26(24(30)27(17)19-8-4-2-5-9-19)16-22(28)25-18-12-14-21(15-13-18)31-20-10-6-3-7-11-20/h2-15,17H,16H2,1H3,(H,25,28) |
| InChIKey | JFJFGMNGQAWATK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|