C19H15ClN4O3 — CID 46696995
N-(3-chloro-4-cyanophenyl)-2-(4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl)acetamide (PubChem CID 46696995) has the molecular formula C19H15ClN4O3 and a molecular weight of 382.81 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-(4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl)acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-(4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 46696995 |
| Molecular Formula | C19H15ClN4O3 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-(4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl)acetamide |
| SMILES | CC1C(=O)N(CC(=O)Nc2ccc(C#N)c(Cl)c2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C19H15ClN4O3/c1-12-18(26)23(19(27)24(12)15-5-3-2-4-6-15)11-17(25)22-14-8-7-13(10-21)16(20)9-14/h2-9,12H,11H2,1H3,(H,22,25) |
| InChIKey | WMONIIXRJZMZSP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|