C19H16Cl3N3O3 — CID 2455847
2-[(4R)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 2455847) has the molecular formula C19H16Cl3N3O3 and a molecular weight of 440.71 g/mol. Its IUPAC name is 2-[(4R)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(4R)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2455847 |
| Molecular Formula | C19H16Cl3N3O3 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 2-[(4R)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)N(CC(=O)Nc3cc(Cl)c(Cl)cc3Cl)C(=O)[C@H]2C)cc1 |
| InChI | InChI=1S/C19H16Cl3N3O3/c1-10-3-5-12(6-4-10)25-11(2)18(27)24(19(25)28)9-17(26)23-16-8-14(21)13(20)7-15(16)22/h3-8,11H,9H2,1-2H3,(H,23,26)/t11-/m1/s1 |
| InChIKey | OGOWXQBNXDMXFV-LLVKDONJSA-N |
| XLogP | 4.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|