C20H21N3O3 — CID 9042802
2-[(4R)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide (PubChem CID 9042802) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-[(4R)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9042802 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-[(4R)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)N(CC(=O)Nc3ccccc3C)C(=O)[C@H]2C)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-13-8-10-16(11-9-13)23-15(3)19(25)22(20(23)26)12-18(24)21-17-7-5-4-6-14(17)2/h4-11,15H,12H2,1-3H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | SWKRJJOJZRLTHZ-OAHLLOKOSA-N |
| XLogP | 3.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|