C18H14F3N3O3 — CID 51611036
N-(2,4-difluorophenyl)-2-[(4R)-3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 51611036) has the molecular formula C18H14F3N3O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[(4R)-3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[(4R)-3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 51611036 |
| Molecular Formula | C18H14F3N3O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[(4R)-3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@H]1C(=O)N(CC(=O)Nc2ccc(F)cc2F)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14F3N3O3/c1-10-17(26)23(18(27)24(10)13-5-2-11(19)3-6-13)9-16(25)22-15-7-4-12(20)8-14(15)21/h2-8,10H,9H2,1H3,(H,22,25)/t10-/m1/s1 |
| InChIKey | LNGMZTQBLDINPG-SNVBAGLBSA-N |
| XLogP | 2.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|